What is the 4-(aminomethyl)octane-1,8-diamine?

4-(aminomethyl)octane-1,8-diamine is , while it's Molecular Formula is C9H23N3. Used in Chemical Synthesis: 4-(aminomethyl)octane-1,8-diamine is used as a building block for the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and specialty chemicals. Its presence of multiple amine groups allows for easy functionalization and modification, making it a valuable intermediate in the chemical industry. Used in Surfactant Production: In the detergent and cleaning products industry, 4-(aminomethyl)octane-1,8-diamine is used as a raw material for the production of surfactants. These surfactants are essential for creating foam and enhancing the cleaning properties of various products, such as shampoos, soaps, and laundry detergents. Used in Polymer Industry: 4-(aminomethyl)octane-1,8-diamine is utilized as a monomer or a chain extender in the polymer industry. Its reactive amine groups can be used to create polyamides, polyureas, and other polymers with specific properties, such as high strength, flexibility, and durability. Used in Coating and Adhesive Formulation: The compound is also used in the formulation of coatings and adhesives due to its ability to form strong bonds with various substrates. Its presence in these formulations can improve the adhesion, durability, and overall performance of the final product. Used in Textile Industry: In the textile industry, 4-(aminomethyl)octane-1,8-diamine is used as a curing agent for epoxy resins, which are commonly employed in the production of durable water repellent (DWR) coatings for fabrics. These coatings provide water resistance and enhance the longevity of the textile products. Used in Corrosion Inhibition: 4-(aminomethyl)octane-1,8-diamine is employed as a corrosion inhibitor in various industrial applications, such as oil and gas pipelines, storage tanks, and other metal structures. Its amine groups can form a protective layer on the metal surface, preventing corrosion and extending the life of the equipment.

What is the CAS number for 4-(aminomethyl)octane-1,8-diamine?

The CAS number of 4-(aminomethyl)octane-1,8-diamine is 1572-55-0.

What is 4-(aminomethyl)octane-1,8-diamine (1572-55-0) used for?

4-(aminomethyl)octane-1,8-diamine, also known as Aminooctane, is a primary amine with an octane skeleton and amino substituents at carbon positions 1 and 8, along with an aminomethyl substituent at position 5. It is a versatile organic compound with various applications across different industries due to its unique molecular structure and properties.InChI:InChI=1/C9H23N3/c10-6-2-1-4-9(8-12)5-3-7-11/h9H,1-8,10-12H2

What is the 4-(aminomethyl)octane-1,8-diamine?

4-(aminomethyl)octane-1,8-diamine is , while it's Molecular Formula is C9H23N3. Used in Chemical Synthesis: 4-(aminomethyl)octane-1,8-diamine is used as a building block for the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and specialty chemicals. Its presence of multiple amine groups allows for easy functionalization and modification, making it a valuable intermediate in the chemical industry. Used in Surfactant Production: In the detergent and cleaning products industry, 4-(aminomethyl)octane-1,8-diamine is used as a raw material for the production of surfactants. These surfactants are essential for creating foam and enhancing the cleaning properties of various products, such as shampoos, soaps, and laundry detergents. Used in Polymer Industry: 4-(aminomethyl)octane-1,8-diamine is utilized as a monomer or a chain extender in the polymer industry. Its reactive amine groups can be used to create polyamides, polyureas, and other polymers with specific properties, such as high strength, flexibility, and durability. Used in Coating and Adhesive Formulation: The compound is also used in the formulation of coatings and adhesives due to its ability to form strong bonds with various substrates. Its presence in these formulations can improve the adhesion, durability, and overall performance of the final product. Used in Textile Industry: In the textile industry, 4-(aminomethyl)octane-1,8-diamine is used as a curing agent for epoxy resins, which are commonly employed in the production of durable water repellent (DWR) coatings for fabrics. These coatings provide water resistance and enhance the longevity of the textile products. Used in Corrosion Inhibition: 4-(aminomethyl)octane-1,8-diamine is employed as a corrosion inhibitor in various industrial applications, such as oil and gas pipelines, storage tanks, and other metal structures. Its amine groups can form a protective layer on the metal surface, preventing corrosion and extending the life of the equipment.

What is the CAS number for 4-(aminomethyl)octane-1,8-diamine?

The CAS number of 4-(aminomethyl)octane-1,8-diamine is 1572-55-0.

What is 4-(aminomethyl)octane-1,8-diamine (1572-55-0) used for?

4-(aminomethyl)octane-1,8-diamine, also known as Aminooctane, is a primary amine with an octane skeleton and amino substituents at carbon positions 1 and 8, along with an aminomethyl substituent at position 5. It is a versatile organic compound with various applications across different industries due to its unique molecular structure and properties.InChI:InChI=1/C9H23N3/c10-6-2-1-4-9(8-12)5-3-7-11/h9H,1-8,10-12H2

4-(aminomethyl)octane-1,8-diamine

High quality purity >99% 4-(aminomethyl)octane-1,8-diamine 1572-55-0 for sale

Molecular Formula: C9H23N3
Molecular Weight: 173.302
Vapor Pressure: 0.000169mmHg at 25°C
Refractive Index: 1.487
Boiling Point: 330.227 °C at 760 mmHg
Flash Point: 167.213 °C
PSA： 78.06000
Density: 0.919 g/cm³
LogP: 2.53010

4-(aminomethyl)octane-1,8-diamine(Cas 1572-55-0) Usage

Definition

ChEBI: A primary amine comprising an octane skeleton with amino substituents at carbon positions 1 and 8; and an aminomethyl substituent at position 5.

InChI:InChI=1/C9H23N3/c10-6-2-1-4-9(8-12)5-3-7-11/h9H,1-8,10-12H2